C13H22N6O2 — CID 136663811
2-amino-4-[4-[(2R)-2-amino-3-methylbutanoyl]piperazin-1-yl]-1H-pyrimidin-6-one (PubChem CID 136663811) has the molecular formula C13H22N6O2 and a molecular weight of 294.36 g/mol. Its IUPAC name is 2-amino-4-[4-[(2R)-2-amino-3-methylbutanoyl]piperazin-1-yl]-1H-pyrimidin-6-one.
| Compound Name | 2-amino-4-[4-[(2R)-2-amino-3-methylbutanoyl]piperazin-1-yl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136663811 |
| Molecular Formula | C13H22N6O2 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 2-amino-4-[4-[(2R)-2-amino-3-methylbutanoyl]piperazin-1-yl]-1H-pyrimidin-6-one |
| SMILES | CC(C)[C@@H](N)C(=O)N1CCN(c2cc(=O)[nH]c(N)n2)CC1 |
| InChI | InChI=1S/C13H22N6O2/c1-8(2)11(14)12(21)19-5-3-18(4-6-19)9-7-10(20)17-13(15)16-9/h7-8,11H,3-6,14H2,1-2H3,(H3,15,16,17,20)/t11-/m1/s1 |
| InChIKey | OPIUEKAWWGFMTN-LLVKDONJSA-N |
| XLogP | -1.02 |
| TPSA | 121.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |