C26H29N3O2 — CID 136666322
4-(6-methoxy-2-pyridinyl)-2-[[4-(3-phenylprop-2-enyl)piperazin-1-yl]methyl]phenol (PubChem CID 136666322) has the molecular formula C26H29N3O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 4-(6-methoxy-2-pyridinyl)-2-[[4-(3-phenylprop-2-enyl)piperazin-1-yl]methyl]phenol.
| Compound Name | 4-(6-methoxy-2-pyridinyl)-2-[[4-(3-phenylprop-2-enyl)piperazin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 136666322 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 4-(6-methoxy-2-pyridinyl)-2-[[4-(3-phenylprop-2-enyl)piperazin-1-yl]methyl]phenol |
| SMILES | COc1cccc(-c2ccc(O)c(CN3CCN(CC=Cc4ccccc4)CC3)c2)n1 |
| InChI | InChI=1S/C26H29N3O2/c1-31-26-11-5-10-24(27-26)22-12-13-25(30)23(19-22)20-29-17-15-28(16-18-29)14-6-9-21-7-3-2-4-8-21/h2-13,19,30H,14-18,20H2,1H3 |
| InChIKey | FDYKWWUHOSWGRY-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 48.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|