C22H24N2O3 — CID 135971339
2-[[(2-hydroxy-2-phenylethyl)-methylamino]methyl]-4-(6-methoxy-2-pyridinyl)phenol (PubChem CID 135971339) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is 2-[[(2-hydroxy-2-phenylethyl)-methylamino]methyl]-4-(6-methoxy-2-pyridinyl)phenol.
| Compound Name | 2-[[(2-hydroxy-2-phenylethyl)-methylamino]methyl]-4-(6-methoxy-2-pyridinyl)phenol |
|---|---|
| PubChem CID | 135971339 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 2-[[(2-hydroxy-2-phenylethyl)-methylamino]methyl]-4-(6-methoxy-2-pyridinyl)phenol |
| SMILES | COc1cccc(-c2ccc(O)c(CN(C)CC(O)c3ccccc3)c2)n1 |
| InChI | InChI=1S/C22H24N2O3/c1-24(15-21(26)16-7-4-3-5-8-16)14-18-13-17(11-12-20(18)25)19-9-6-10-22(23-19)27-2/h3-13,21,25-26H,14-15H2,1-2H3 |
| InChIKey | WCYZNTRPZPRTFR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 65.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|