C21H21ClN2O2 — CID 136967884
2-[[2-(3-chlorophenyl)ethylamino]methyl]-4-(6-methoxy-2-pyridinyl)phenol (PubChem CID 136967884) has the molecular formula C21H21ClN2O2 and a molecular weight of 368.86 g/mol. Its IUPAC name is 2-[[2-(3-chlorophenyl)ethylamino]methyl]-4-(6-methoxy-2-pyridinyl)phenol.
| Compound Name | 2-[[2-(3-chlorophenyl)ethylamino]methyl]-4-(6-methoxy-2-pyridinyl)phenol |
|---|---|
| PubChem CID | 136967884 |
| Molecular Formula | C21H21ClN2O2 |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 2-[[2-(3-chlorophenyl)ethylamino]methyl]-4-(6-methoxy-2-pyridinyl)phenol |
| SMILES | COc1cccc(-c2ccc(O)c(CNCCc3cccc(Cl)c3)c2)n1 |
| InChI | InChI=1S/C21H21ClN2O2/c1-26-21-7-3-6-19(24-21)16-8-9-20(25)17(13-16)14-23-11-10-15-4-2-5-18(22)12-15/h2-9,12-13,23,25H,10-11,14H2,1H3 |
| InChIKey | BPMKSOGKKSTNMG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|