C14H15N3O2 — CID 136666350
6-oxo-N-(2,4,6-trimethylphenyl)-1H-pyrimidine-4-carboxamide (PubChem CID 136666350) has the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. Its IUPAC name is 6-oxo-N-(2,4,6-trimethylphenyl)-1H-pyrimidine-4-carboxamide.
| Compound Name | 6-oxo-N-(2,4,6-trimethylphenyl)-1H-pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 136666350 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 6-oxo-N-(2,4,6-trimethylphenyl)-1H-pyrimidine-4-carboxamide |
| SMILES | Cc1cc(C)c(NC(=O)c2cc(=O)[nH]cn2)c(C)c1 |
| InChI | InChI=1S/C14H15N3O2/c1-8-4-9(2)13(10(3)5-8)17-14(19)11-6-12(18)16-7-15-11/h4-7H,1-3H3,(H,17,19)(H,15,16,18) |
| InChIKey | MFYWAQVCTRBTIY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |