C20H23N5O3 — CID 136667355
(5S,7R)-5-(4-methylphenyl)-7-(2,3,4-trimethoxyphenyl)-4,5,6,7-tetrahydrotetrazolo[1,5-a]pyrimidine (PubChem CID 136667355) has the molecular formula C20H23N5O3 and a molecular weight of 381.44 g/mol. Its IUPAC name is (5S,7R)-5-(4-methylphenyl)-7-(2,3,4-trimethoxyphenyl)-4,5,6,7-tetrahydrotetrazolo[1,5-a]pyrimidine.
| Compound Name | (5S,7R)-5-(4-methylphenyl)-7-(2,3,4-trimethoxyphenyl)-4,5,6,7-tetrahydrotetrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 136667355 |
| Molecular Formula | C20H23N5O3 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | (5S,7R)-5-(4-methylphenyl)-7-(2,3,4-trimethoxyphenyl)-4,5,6,7-tetrahydrotetrazolo[1,5-a]pyrimidine |
| SMILES | COc1ccc([C@H]2C[C@@H](c3ccc(C)cc3)Nc3nnnn32)c(OC)c1OC |
| InChI | InChI=1S/C20H23N5O3/c1-12-5-7-13(8-6-12)15-11-16(25-20(21-15)22-23-24-25)14-9-10-17(26-2)19(28-4)18(14)27-3/h5-10,15-16H,11H2,1-4H3,(H,21,22,24)/t15-,16+/m0/s1 |
| InChIKey | ZTMBOVFZGHOUAN-JKSUJKDBSA-N |
| XLogP | 3.15 |
| TPSA | 83.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |