C21H25N5O4 — CID 136667698
(5S,7S)-5-(4-ethoxyphenyl)-7-(3,4,5-trimethoxyphenyl)-4,5,6,7-tetrahydrotetrazolo[1,5-a]pyrimidine (PubChem CID 136667698) has the molecular formula C21H25N5O4 and a molecular weight of 411.46 g/mol. Its IUPAC name is (5S,7S)-5-(4-ethoxyphenyl)-7-(3,4,5-trimethoxyphenyl)-4,5,6,7-tetrahydrotetrazolo[1,5-a]pyrimidine.
| Compound Name | (5S,7S)-5-(4-ethoxyphenyl)-7-(3,4,5-trimethoxyphenyl)-4,5,6,7-tetrahydrotetrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 136667698 |
| Molecular Formula | C21H25N5O4 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | (5S,7S)-5-(4-ethoxyphenyl)-7-(3,4,5-trimethoxyphenyl)-4,5,6,7-tetrahydrotetrazolo[1,5-a]pyrimidine |
| SMILES | CCOc1ccc([C@@H]2C[C@@H](c3cc(OC)c(OC)c(OC)c3)n3nnnc3N2)cc1 |
| InChI | InChI=1S/C21H25N5O4/c1-5-30-15-8-6-13(7-9-15)16-12-17(26-21(22-16)23-24-25-26)14-10-18(27-2)20(29-4)19(11-14)28-3/h6-11,16-17H,5,12H2,1-4H3,(H,22,23,25)/t16-,17-/m0/s1 |
| InChIKey | WOXJWTQGACTHBM-IRXDYDNUSA-N |
| XLogP | 3.24 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |