C20H23N5O2 — CID 136667644
(5S,7R)-7-(2,5-dimethoxyphenyl)-5-(4-ethylphenyl)-4,5,6,7-tetrahydrotetrazolo[1,5-a]pyrimidine (PubChem CID 136667644) has the molecular formula C20H23N5O2 and a molecular weight of 365.44 g/mol. Its IUPAC name is (5S,7R)-7-(2,5-dimethoxyphenyl)-5-(4-ethylphenyl)-4,5,6,7-tetrahydrotetrazolo[1,5-a]pyrimidine.
| Compound Name | (5S,7R)-7-(2,5-dimethoxyphenyl)-5-(4-ethylphenyl)-4,5,6,7-tetrahydrotetrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 136667644 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | (5S,7R)-7-(2,5-dimethoxyphenyl)-5-(4-ethylphenyl)-4,5,6,7-tetrahydrotetrazolo[1,5-a]pyrimidine |
| SMILES | CCc1ccc([C@@H]2C[C@H](c3cc(OC)ccc3OC)n3nnnc3N2)cc1 |
| InChI | InChI=1S/C20H23N5O2/c1-4-13-5-7-14(8-6-13)17-12-18(25-20(21-17)22-23-24-25)16-11-15(26-2)9-10-19(16)27-3/h5-11,17-18H,4,12H2,1-3H3,(H,21,22,24)/t17-,18+/m0/s1 |
| InChIKey | VXZMORRSAAADOT-ZWKOTPCHSA-N |
| XLogP | 3.40 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |