C29H23NOS — CID 136669033
2-[6-(9,9-dimethylfluoren-2-yl)-1,3-benzothiazol-2-yl]-4-methylphenol (PubChem CID 136669033) has the molecular formula C29H23NOS and a molecular weight of 433.58 g/mol. Its IUPAC name is 2-[6-(9,9-dimethylfluoren-2-yl)-1,3-benzothiazol-2-yl]-4-methylphenol.
| Compound Name | 2-[6-(9,9-dimethylfluoren-2-yl)-1,3-benzothiazol-2-yl]-4-methylphenol |
|---|---|
| PubChem CID | 136669033 |
| Molecular Formula | C29H23NOS |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 2-[6-(9,9-dimethylfluoren-2-yl)-1,3-benzothiazol-2-yl]-4-methylphenol |
| SMILES | Cc1ccc(O)c(-c2nc3ccc(-c4ccc5c(c4)C(C)(C)c4ccccc4-5)cc3s2)c1 |
| InChI | InChI=1S/C29H23NOS/c1-17-8-13-26(31)22(14-17)28-30-25-12-10-19(16-27(25)32-28)18-9-11-21-20-6-4-5-7-23(20)29(2,3)24(21)15-18/h4-16,31H,1-3H3 |
| InChIKey | HGEIKURNGQYHAW-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |