C12H14N8O — CID 136675875
N'-hydroxy-1-(2-propan-2-ylpyrazolo[1,5-a]pyrazin-4-yl)-1,2,4-triazole-3-carboximidamide (PubChem CID 136675875) has the molecular formula C12H14N8O and a molecular weight of 286.30 g/mol. Its IUPAC name is N'-hydroxy-1-(2-propan-2-ylpyrazolo[1,5-a]pyrazin-4-yl)-1,2,4-triazole-3-carboximidamide.
| Compound Name | N'-hydroxy-1-(2-propan-2-ylpyrazolo[1,5-a]pyrazin-4-yl)-1,2,4-triazole-3-carboximidamide |
|---|---|
| PubChem CID | 136675875 |
| Molecular Formula | C12H14N8O |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | N'-hydroxy-1-(2-propan-2-ylpyrazolo[1,5-a]pyrazin-4-yl)-1,2,4-triazole-3-carboximidamide |
| SMILES | CC(C)c1cc2c(-n3cnc(/C(N)=N/O)n3)nccn2n1 |
| InChI | InChI=1S/C12H14N8O/c1-7(2)8-5-9-12(14-3-4-19(9)16-8)20-6-15-11(17-20)10(13)18-21/h3-7,21H,1-2H3,(H2,13,18) |
| InChIKey | WRHSHURGXFIVTM-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|