C10H22IN3O2 — CID 136678004
2-[3-(2-methoxyethoxy)propyl]-1-prop-2-enylguanidine;hydroiodide (PubChem CID 136678004) has the molecular formula C10H22IN3O2 and a molecular weight of 343.21 g/mol. Its IUPAC name is 2-[3-(2-methoxyethoxy)propyl]-1-prop-2-enylguanidine;hydroiodide.
| Compound Name | 2-[3-(2-methoxyethoxy)propyl]-1-prop-2-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 136678004 |
| Molecular Formula | C10H22IN3O2 |
| Molecular Weight | 343.21 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 2-[3-(2-methoxyethoxy)propyl]-1-prop-2-enylguanidine;hydroiodide |
| SMILES | C=CCN/C(N)=N/CCCOCCOC.I |
| InChI | InChI=1S/C10H21N3O2.HI/c1-3-5-12-10(11)13-6-4-7-15-9-8-14-2;/h3H,1,4-9H2,2H3,(H3,11,12,13);1H |
| InChIKey | OOXMIUQPTBLPAM-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.21 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|