C18H15N3O4 — CID 136680364
2-[[(4Z)-4-[(4-methoxyphenyl)methylidene]-5-oxoimidazolidin-2-ylidene]amino]benzoic acid (PubChem CID 136680364) has the molecular formula C18H15N3O4 and a molecular weight of 337.34 g/mol. Its IUPAC name is 2-[[(4Z)-4-[(4-methoxyphenyl)methylidene]-5-oxoimidazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 2-[[(4Z)-4-[(4-methoxyphenyl)methylidene]-5-oxoimidazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 136680364 |
| Molecular Formula | C18H15N3O4 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 2-[[(4Z)-4-[(4-methoxyphenyl)methylidene]-5-oxoimidazolidin-2-ylidene]amino]benzoic acid |
| SMILES | COc1ccc(/C=C2\N/C(=N/c3ccccc3C(=O)O)NC2=O)cc1 |
| InChI | InChI=1S/C18H15N3O4/c1-25-12-8-6-11(7-9-12)10-15-16(22)21-18(20-15)19-14-5-3-2-4-13(14)17(23)24/h2-10H,1H3,(H,23,24)(H2,19,20,21,22)/b15-10- |
| InChIKey | RSCLVMBFENHVBR-GDNBJRDFSA-N |
| XLogP | 2.14 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|