C21H28N6O — CID 136680910
(6aS,9aR)-8-[(1-ethenyl-5-methylpyrazol-4-yl)methyl]-2-pyrrolidin-1-yl-5,6,6a,7,9,9a-hexahydro-3H-pyrrolo[3,4-h]quinazolin-4-one (PubChem CID 136680910) has the molecular formula C21H28N6O and a molecular weight of 380.50 g/mol. Its IUPAC name is (6aS,9aR)-8-[(1-ethenyl-5-methylpyrazol-4-yl)methyl]-2-pyrrolidin-1-yl-5,6,6a,7,9,9a-hexahydro-3H-pyrrolo[3,4-h]quinazolin-4-one.
| Compound Name | (6aS,9aR)-8-[(1-ethenyl-5-methylpyrazol-4-yl)methyl]-2-pyrrolidin-1-yl-5,6,6a,7,9,9a-hexahydro-3H-pyrrolo[3,4-h]quinazolin-4-one |
|---|---|
| PubChem CID | 136680910 |
| Molecular Formula | C21H28N6O |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | (6aS,9aR)-8-[(1-ethenyl-5-methylpyrazol-4-yl)methyl]-2-pyrrolidin-1-yl-5,6,6a,7,9,9a-hexahydro-3H-pyrrolo[3,4-h]quinazolin-4-one |
| SMILES | C=Cn1ncc(CN2C[C@H]3CCc4c(nc(N5CCCC5)[nH]c4=O)[C@H]3C2)c1C |
| InChI | InChI=1S/C21H28N6O/c1-3-27-14(2)16(10-22-27)12-25-11-15-6-7-17-19(18(15)13-25)23-21(24-20(17)28)26-8-4-5-9-26/h3,10,15,18H,1,4-9,11-13H2,2H3,(H,23,24,28)/t15-,18+/m1/s1 |
| InChIKey | PXZQZMZSYVSEQZ-QAPCUYQASA-N |
| XLogP | 2.14 |
| TPSA | 70.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |