C21H26N4O3 — CID 136798395
(6aS,9aR)-8-[(1S,2S,4S)-7-oxabicyclo[2.2.1]hept-5-ene-2-carbonyl]-2-pyrrolidin-1-yl-5,6,6a,7,9,9a-hexahydro-3H-pyrrolo[3,4-h]quinazolin-4-one (PubChem CID 136798395) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is (6aS,9aR)-8-[(1S,2S,4S)-7-oxabicyclo[2.2.1]hept-5-ene-2-carbonyl]-2-pyrrolidin-1-yl-5,6,6a,7,9,9a-hexahydro-3H-pyrrolo[3,4-h]quinazolin-4-one.
| Compound Name | (6aS,9aR)-8-[(1S,2S,4S)-7-oxabicyclo[2.2.1]hept-5-ene-2-carbonyl]-2-pyrrolidin-1-yl-5,6,6a,7,9,9a-hexahydro-3H-pyrrolo[3,4-h]quinazolin-4-one |
|---|---|
| PubChem CID | 136798395 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | (6aS,9aR)-8-[(1S,2S,4S)-7-oxabicyclo[2.2.1]hept-5-ene-2-carbonyl]-2-pyrrolidin-1-yl-5,6,6a,7,9,9a-hexahydro-3H-pyrrolo[3,4-h]quinazolin-4-one |
| SMILES | O=C([C@H]1C[C@H]2C=C[C@@H]1O2)N1C[C@H]2CCc3c(nc(N4CCCC4)[nH]c3=O)[C@H]2C1 |
| InChI | InChI=1S/C21H26N4O3/c26-19-14-5-3-12-10-25(20(27)15-9-13-4-6-17(15)28-13)11-16(12)18(14)22-21(23-19)24-7-1-2-8-24/h4,6,12-13,15-17H,1-3,5,7-11H2,(H,22,23,26)/t12-,13-,15+,16+,17+/m1/s1 |
| InChIKey | ZCMXVBBQESUFSH-WLGNDBIMSA-N |
| XLogP | 1.20 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|