C21H18F3N3O3S — CID 136685584
2-[[4-(4-methoxyphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-N-(2,3,4-trifluorophenyl)butanamide (PubChem CID 136685584) has the molecular formula C21H18F3N3O3S and a molecular weight of 449.45 g/mol. Its IUPAC name is 2-[[4-(4-methoxyphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-N-(2,3,4-trifluorophenyl)butanamide.
| Compound Name | 2-[[4-(4-methoxyphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-N-(2,3,4-trifluorophenyl)butanamide |
|---|---|
| PubChem CID | 136685584 |
| Molecular Formula | C21H18F3N3O3S |
| Molecular Weight | 449.45 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | 2-[[4-(4-methoxyphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-N-(2,3,4-trifluorophenyl)butanamide |
| SMILES | CCC(Sc1nc(-c2ccc(OC)cc2)cc(=O)[nH]1)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C21H18F3N3O3S/c1-3-16(20(29)25-14-9-8-13(22)18(23)19(14)24)31-21-26-15(10-17(28)27-21)11-4-6-12(30-2)7-5-11/h4-10,16H,3H2,1-2H3,(H,25,29)(H,26,27,28) |
| InChIKey | NCLWKDADOCWPCP-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.45 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|