C18H21F2N3O2S2 — CID 136686791
N-(2,4-difluorophenyl)-2-[[6-oxo-4-(propylsulfanylmethyl)-1H-pyrimidin-2-yl]sulfanyl]butanamide (PubChem CID 136686791) has the molecular formula C18H21F2N3O2S2 and a molecular weight of 413.52 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-[[6-oxo-4-(propylsulfanylmethyl)-1H-pyrimidin-2-yl]sulfanyl]butanamide.
| Compound Name | N-(2,4-difluorophenyl)-2-[[6-oxo-4-(propylsulfanylmethyl)-1H-pyrimidin-2-yl]sulfanyl]butanamide |
|---|---|
| PubChem CID | 136686791 |
| Molecular Formula | C18H21F2N3O2S2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-[[6-oxo-4-(propylsulfanylmethyl)-1H-pyrimidin-2-yl]sulfanyl]butanamide |
| SMILES | CCCSCc1cc(=O)[nH]c(SC(CC)C(=O)Nc2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C18H21F2N3O2S2/c1-3-7-26-10-12-9-16(24)23-18(21-12)27-15(4-2)17(25)22-14-6-5-11(19)8-13(14)20/h5-6,8-9,15H,3-4,7,10H2,1-2H3,(H,22,25)(H,21,23,24) |
| InChIKey | SWWPSKHEOANRSA-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|