C22H25N5O5 — CID 136691668
ethyl (Z)-4-[2-[[4-(dimethylamino)phenyl]methylidene]hydrazinyl]-2-hydroxy-3-[(2-methoxyphenyl)diazenyl]-4-oxobut-2-enoate (PubChem CID 136691668) has the molecular formula C22H25N5O5 and a molecular weight of 439.47 g/mol. Its IUPAC name is ethyl (Z)-4-[2-[[4-(dimethylamino)phenyl]methylidene]hydrazinyl]-2-hydroxy-3-[(2-methoxyphenyl)diazenyl]-4-oxobut-2-enoate.
| Compound Name | ethyl (Z)-4-[2-[[4-(dimethylamino)phenyl]methylidene]hydrazinyl]-2-hydroxy-3-[(2-methoxyphenyl)diazenyl]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 136691668 |
| Molecular Formula | C22H25N5O5 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | ethyl (Z)-4-[2-[[4-(dimethylamino)phenyl]methylidene]hydrazinyl]-2-hydroxy-3-[(2-methoxyphenyl)diazenyl]-4-oxobut-2-enoate |
| SMILES | CCOC(=O)/C(O)=C(/N=N/c1ccccc1OC)C(=O)NN=Cc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C22H25N5O5/c1-5-32-22(30)20(28)19(25-24-17-8-6-7-9-18(17)31-4)21(29)26-23-14-15-10-12-16(13-11-15)27(2)3/h6-14,28H,5H2,1-4H3,(H,26,29)/b20-19-,23-14?,25-24+ |
| InChIKey | SFWUTFRYYZFAGU-PWSAOINYSA-N |
| XLogP | 3.33 |
| TPSA | 125.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|