C10H12N4O — CID 136692282
5-ethyl-4-(1-methylpyrazol-4-yl)-1H-pyrimidin-6-one (PubChem CID 136692282) has the molecular formula C10H12N4O and a molecular weight of 204.23 g/mol. Its IUPAC name is 5-ethyl-4-(1-methylpyrazol-4-yl)-1H-pyrimidin-6-one.
| Compound Name | 5-ethyl-4-(1-methylpyrazol-4-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136692282 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 5-ethyl-4-(1-methylpyrazol-4-yl)-1H-pyrimidin-6-one |
| SMILES | CCc1c(-c2cnn(C)c2)nc[nH]c1=O |
| InChI | InChI=1S/C10H12N4O/c1-3-8-9(11-6-12-10(8)15)7-4-13-14(2)5-7/h4-6H,3H2,1-2H3,(H,11,12,15) |
| InChIKey | QSEDHMCCBVTRGF-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |