C12H9F3N2O — CID 136692786
5-ethyl-4-(2,3,4-trifluorophenyl)-1H-pyrimidin-6-one (PubChem CID 136692786) has the molecular formula C12H9F3N2O and a molecular weight of 254.21 g/mol. Its IUPAC name is 5-ethyl-4-(2,3,4-trifluorophenyl)-1H-pyrimidin-6-one.
| Compound Name | 5-ethyl-4-(2,3,4-trifluorophenyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136692786 |
| Molecular Formula | C12H9F3N2O |
| Molecular Weight | 254.21 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 5-ethyl-4-(2,3,4-trifluorophenyl)-1H-pyrimidin-6-one |
| SMILES | CCc1c(-c2ccc(F)c(F)c2F)nc[nH]c1=O |
| InChI | InChI=1S/C12H9F3N2O/c1-2-6-11(16-5-17-12(6)18)7-3-4-8(13)10(15)9(7)14/h3-5H,2H2,1H3,(H,16,17,18) |
| InChIKey | YKKGYRWPAQVEQX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.21 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|