C14H11BrF3N — CID 175249853
2-bromo-3-ethyl-6-methyl-4-(2,3,4-trifluorophenyl)pyridine (PubChem CID 175249853) has the molecular formula C14H11BrF3N and a molecular weight of 330.15 g/mol. Its IUPAC name is 2-bromo-3-ethyl-6-methyl-4-(2,3,4-trifluorophenyl)pyridine.
| Compound Name | 2-bromo-3-ethyl-6-methyl-4-(2,3,4-trifluorophenyl)pyridine |
|---|---|
| PubChem CID | 175249853 |
| Molecular Formula | C14H11BrF3N |
| Molecular Weight | 330.15 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | 2-bromo-3-ethyl-6-methyl-4-(2,3,4-trifluorophenyl)pyridine |
| SMILES | CCc1c(-c2ccc(F)c(F)c2F)cc(C)nc1Br |
| InChI | InChI=1S/C14H11BrF3N/c1-3-8-10(6-7(2)19-14(8)15)9-4-5-11(16)13(18)12(9)17/h4-6H,3H2,1-2H3 |
| InChIKey | RSNPFCKWQAGRKO-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.15 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|