C11H6BrF4N3 — CID 122456058
5-(2-bromo-3-fluoro-6-methyl-4-pyridinyl)-2-(trifluoromethyl)pyrimidine (PubChem CID 122456058) has the molecular formula C11H6BrF4N3 and a molecular weight of 336.09 g/mol. Its IUPAC name is 5-(2-bromo-3-fluoro-6-methyl-4-pyridinyl)-2-(trifluoromethyl)pyrimidine.
| Compound Name | 5-(2-bromo-3-fluoro-6-methyl-4-pyridinyl)-2-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 122456058 |
| Molecular Formula | C11H6BrF4N3 |
| Molecular Weight | 336.09 g/mol |
| Exact Mass | 334.97 |
| IUPAC Name | 5-(2-bromo-3-fluoro-6-methyl-4-pyridinyl)-2-(trifluoromethyl)pyrimidine |
| SMILES | Cc1cc(-c2cnc(C(F)(F)F)nc2)c(F)c(Br)n1 |
| InChI | InChI=1S/C11H6BrF4N3/c1-5-2-7(8(13)9(12)19-5)6-3-17-10(18-4-6)11(14,15)16/h2-4H,1H3 |
| InChIKey | JEGVKKODNDMHBM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.09 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|