C36H45NO5 — CID 136694534
[4-[(4S)-4-[(2S)-butan-2-yl]-4,5-dihydro-1,3-oxazol-2-yl]-3-hydroxyphenyl] 4-(4-decoxyphenyl)benzoate (PubChem CID 136694534) has the molecular formula C36H45NO5 and a molecular weight of 571.76 g/mol. Its IUPAC name is [4-[(4S)-4-[(2S)-butan-2-yl]-4,5-dihydro-1,3-oxazol-2-yl]-3-hydroxyphenyl] 4-(4-decoxyphenyl)benzoate.
| Compound Name | [4-[(4S)-4-[(2S)-butan-2-yl]-4,5-dihydro-1,3-oxazol-2-yl]-3-hydroxyphenyl] 4-(4-decoxyphenyl)benzoate |
|---|---|
| PubChem CID | 136694534 |
| Molecular Formula | C36H45NO5 |
| Molecular Weight | 571.76 g/mol |
| Exact Mass | 571.33 |
| IUPAC Name | [4-[(4S)-4-[(2S)-butan-2-yl]-4,5-dihydro-1,3-oxazol-2-yl]-3-hydroxyphenyl] 4-(4-decoxyphenyl)benzoate |
| SMILES | CCCCCCCCCCOc1ccc(-c2ccc(C(=O)Oc3ccc(C4=N[C@@H]([C@@H](C)CC)CO4)c(O)c3)cc2)cc1 |
| InChI | InChI=1S/C36H45NO5/c1-4-6-7-8-9-10-11-12-23-40-30-19-17-28(18-20-30)27-13-15-29(16-14-27)36(39)42-31-21-22-32(34(38)24-31)35-37-33(25-41-35)26(3)5-2/h13-22,24,26,33,38H,4-12,23,25H2,1-3H3/t26-,33+/m0/s1 |
| InChIKey | JXXJODJTFQPYCM-OOOSNSGVSA-N |
| XLogP | 8.99 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.76 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|