C22H35NO3 — CID 136694445
5-decoxy-2-(4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)phenol (PubChem CID 136694445) has the molecular formula C22H35NO3 and a molecular weight of 361.53 g/mol. Its IUPAC name is 5-decoxy-2-(4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)phenol.
| Compound Name | 5-decoxy-2-(4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)phenol |
|---|---|
| PubChem CID | 136694445 |
| Molecular Formula | C22H35NO3 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.26 |
| IUPAC Name | 5-decoxy-2-(4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)phenol |
| SMILES | CCCCCCCCCCOc1ccc(C2=NC(C(C)C)CO2)c(O)c1 |
| InChI | InChI=1S/C22H35NO3/c1-4-5-6-7-8-9-10-11-14-25-18-12-13-19(21(24)15-18)22-23-20(16-26-22)17(2)3/h12-13,15,17,20,24H,4-11,14,16H2,1-3H3 |
| InChIKey | UHMFOCSSMPIMAR-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|