C12H8N4O2S — CID 136695178
2-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-5-formylbenzonitrile (PubChem CID 136695178) has the molecular formula C12H8N4O2S and a molecular weight of 272.29 g/mol. Its IUPAC name is 2-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-5-formylbenzonitrile.
| Compound Name | 2-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-5-formylbenzonitrile |
|---|---|
| PubChem CID | 136695178 |
| Molecular Formula | C12H8N4O2S |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 2-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-5-formylbenzonitrile |
| SMILES | N#Cc1cc(C=O)ccc1Sc1nc(N)cc(=O)[nH]1 |
| InChI | InChI=1S/C12H8N4O2S/c13-5-8-3-7(6-17)1-2-9(8)19-12-15-10(14)4-11(18)16-12/h1-4,6H,(H3,14,15,16,18) |
| InChIKey | CAHKMAGWZYEIMS-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|