C20H20N4O3 — CID 136700005
methyl 2-hydroxy-3-[(3-pyrrolidin-1-ylquinoxalin-2-yl)amino]benzoate (PubChem CID 136700005) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is methyl 2-hydroxy-3-[(3-pyrrolidin-1-ylquinoxalin-2-yl)amino]benzoate.
| Compound Name | methyl 2-hydroxy-3-[(3-pyrrolidin-1-ylquinoxalin-2-yl)amino]benzoate |
|---|---|
| PubChem CID | 136700005 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | methyl 2-hydroxy-3-[(3-pyrrolidin-1-ylquinoxalin-2-yl)amino]benzoate |
| SMILES | COC(=O)c1cccc(Nc2nc3ccccc3nc2N2CCCC2)c1O |
| InChI | InChI=1S/C20H20N4O3/c1-27-20(26)13-7-6-10-16(17(13)25)22-18-19(24-11-4-5-12-24)23-15-9-3-2-8-14(15)21-18/h2-3,6-10,25H,4-5,11-12H2,1H3,(H,21,22) |
| InChIKey | CSOUABOFWMYUII-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|