C9H16F3N3O — CID 136700094
1-prop-2-enyl-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine (PubChem CID 136700094) has the molecular formula C9H16F3N3O and a molecular weight of 239.24 g/mol. Its IUPAC name is 1-prop-2-enyl-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine.
| Compound Name | 1-prop-2-enyl-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 136700094 |
| Molecular Formula | C9H16F3N3O |
| Molecular Weight | 239.24 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 1-prop-2-enyl-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine |
| SMILES | C=CCN/C(N)=N/CCCOCC(F)(F)F |
| InChI | InChI=1S/C9H16F3N3O/c1-2-4-14-8(13)15-5-3-6-16-7-9(10,11)12/h2H,1,3-7H2,(H3,13,14,15) |
| InChIKey | PLDXPFSXDZBGRB-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.24 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|