C10H19F3IN3O — CID 111057739
2-(2-methylprop-2-enyl)-1-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide (PubChem CID 111057739) has the molecular formula C10H19F3IN3O and a molecular weight of 381.18 g/mol. Its IUPAC name is 2-(2-methylprop-2-enyl)-1-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 2-(2-methylprop-2-enyl)-1-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111057739 |
| Molecular Formula | C10H19F3IN3O |
| Molecular Weight | 381.18 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | 2-(2-methylprop-2-enyl)-1-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide |
| SMILES | C=C(C)C/N=C(\N)NCCCOCC(F)(F)F.I |
| InChI | InChI=1S/C10H18F3N3O.HI/c1-8(2)6-16-9(14)15-4-3-5-17-7-10(11,12)13;/h1,3-7H2,2H3,(H3,14,15,16);1H |
| InChIKey | BWWGFMAPEHFMKY-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.18 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|