C10H21N3O2 — CID 136678005
2-[3-(2-methoxyethoxy)propyl]-1-prop-2-enylguanidine (PubChem CID 136678005) has the molecular formula C10H21N3O2 and a molecular weight of 215.30 g/mol. Its IUPAC name is 2-[3-(2-methoxyethoxy)propyl]-1-prop-2-enylguanidine.
| Compound Name | 2-[3-(2-methoxyethoxy)propyl]-1-prop-2-enylguanidine |
|---|---|
| PubChem CID | 136678005 |
| Molecular Formula | C10H21N3O2 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.16 |
| IUPAC Name | 2-[3-(2-methoxyethoxy)propyl]-1-prop-2-enylguanidine |
| SMILES | C=CCN/C(N)=N/CCCOCCOC |
| InChI | InChI=1S/C10H21N3O2/c1-3-5-12-10(11)13-6-4-7-15-9-8-14-2/h3H,1,4-9H2,2H3,(H3,11,12,13) |
| InChIKey | JTKRJFFHDJWSPD-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|