C13H22N4S — CID 136702708
2-[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]-1-ethyl-3-prop-2-enylguanidine (PubChem CID 136702708) has the molecular formula C13H22N4S and a molecular weight of 266.41 g/mol. Its IUPAC name is 2-[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]-1-ethyl-3-prop-2-enylguanidine.
| Compound Name | 2-[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]-1-ethyl-3-prop-2-enylguanidine |
|---|---|
| PubChem CID | 136702708 |
| Molecular Formula | C13H22N4S |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 2-[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]-1-ethyl-3-prop-2-enylguanidine |
| SMILES | C=CCN/C(=N/CCc1nc(C)c(C)s1)NCC |
| InChI | InChI=1S/C13H22N4S/c1-5-8-15-13(14-6-2)16-9-7-12-17-10(3)11(4)18-12/h5H,1,6-9H2,2-4H3,(H2,14,15,16) |
| InChIKey | OIFXRZGWXBSNRV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|