C15H10N2O4 — CID 136707547
quinoxalin-2-yl-(3,4,5-trihydroxyphenyl)methanone (PubChem CID 136707547) has the molecular formula C15H10N2O4 and a molecular weight of 282.25 g/mol. Its IUPAC name is quinoxalin-2-yl-(3,4,5-trihydroxyphenyl)methanone.
| Compound Name | quinoxalin-2-yl-(3,4,5-trihydroxyphenyl)methanone |
|---|---|
| PubChem CID | 136707547 |
| Molecular Formula | C15H10N2O4 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | quinoxalin-2-yl-(3,4,5-trihydroxyphenyl)methanone |
| SMILES | O=C(c1cc(O)c(O)c(O)c1)c1cnc2ccccc2n1 |
| InChI | InChI=1S/C15H10N2O4/c18-12-5-8(6-13(19)15(12)21)14(20)11-7-16-9-3-1-2-4-10(9)17-11/h1-7,18-19,21H |
| InChIKey | ZFYUBWXZQYUOQP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|