C15H7F3N2O — CID 107356717
quinoxalin-2-yl-(2,3,4-trifluorophenyl)methanone (PubChem CID 107356717) has the molecular formula C15H7F3N2O and a molecular weight of 288.23 g/mol. Its IUPAC name is quinoxalin-2-yl-(2,3,4-trifluorophenyl)methanone.
| Compound Name | quinoxalin-2-yl-(2,3,4-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 107356717 |
| Molecular Formula | C15H7F3N2O |
| Molecular Weight | 288.23 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | quinoxalin-2-yl-(2,3,4-trifluorophenyl)methanone |
| SMILES | O=C(c1cnc2ccccc2n1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H7F3N2O/c16-9-6-5-8(13(17)14(9)18)15(21)12-7-19-10-3-1-2-4-11(10)20-12/h1-7H |
| InChIKey | KEVOGXXOYAAFDE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.23 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|