C9H13F3N4 — CID 136709329
7-propan-2-yl-2-(trifluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 136709329) has the molecular formula C9H13F3N4 and a molecular weight of 234.22 g/mol. Its IUPAC name is 7-propan-2-yl-2-(trifluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 7-propan-2-yl-2-(trifluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 136709329 |
| Molecular Formula | C9H13F3N4 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 7-propan-2-yl-2-(trifluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | CC(C)C1CCNc2nc(C(F)(F)F)nn21 |
| InChI | InChI=1S/C9H13F3N4/c1-5(2)6-3-4-13-8-14-7(9(10,11)12)15-16(6)8/h5-6H,3-4H2,1-2H3,(H,13,14,15) |
| InChIKey | TYVOCJOZEWVYBT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |