C11H11F3N4S — CID 136709306
7-(3-methylthiophen-2-yl)-2-(trifluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 136709306) has the molecular formula C11H11F3N4S and a molecular weight of 288.30 g/mol. Its IUPAC name is 7-(3-methylthiophen-2-yl)-2-(trifluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 7-(3-methylthiophen-2-yl)-2-(trifluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 136709306 |
| Molecular Formula | C11H11F3N4S |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 7-(3-methylthiophen-2-yl)-2-(trifluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | Cc1ccsc1C1CCNc2nc(C(F)(F)F)nn21 |
| InChI | InChI=1S/C11H11F3N4S/c1-6-3-5-19-8(6)7-2-4-15-10-16-9(11(12,13)14)17-18(7)10/h3,5,7H,2,4H2,1H3,(H,15,16,17) |
| InChIKey | WAFZRFSWFSMFIO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |