C12H9F5N4 — CID 136709297
7-(2,4-difluorophenyl)-2-(trifluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 136709297) has the molecular formula C12H9F5N4 and a molecular weight of 304.22 g/mol. Its IUPAC name is 7-(2,4-difluorophenyl)-2-(trifluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 7-(2,4-difluorophenyl)-2-(trifluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 136709297 |
| Molecular Formula | C12H9F5N4 |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 7-(2,4-difluorophenyl)-2-(trifluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | Fc1ccc(C2CCNc3nc(C(F)(F)F)nn32)c(F)c1 |
| InChI | InChI=1S/C12H9F5N4/c13-6-1-2-7(8(14)5-6)9-3-4-18-11-19-10(12(15,16)17)20-21(9)11/h1-2,5,9H,3-4H2,(H,18,19,20) |
| InChIKey | HHUXNCGPXLEIAD-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |