C14H15FN4O2 — CID 136775985
methyl 2-[7-(4-fluorophenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]acetate (PubChem CID 136775985) has the molecular formula C14H15FN4O2 and a molecular weight of 290.30 g/mol. Its IUPAC name is methyl 2-[7-(4-fluorophenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]acetate.
| Compound Name | methyl 2-[7-(4-fluorophenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]acetate |
|---|---|
| PubChem CID | 136775985 |
| Molecular Formula | C14H15FN4O2 |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | methyl 2-[7-(4-fluorophenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]acetate |
| SMILES | COC(=O)Cc1nc2n(n1)C(c1ccc(F)cc1)CCN2 |
| InChI | InChI=1S/C14H15FN4O2/c1-21-13(20)8-12-17-14-16-7-6-11(19(14)18-12)9-2-4-10(15)5-3-9/h2-5,11H,6-8H2,1H3,(H,16,17,18) |
| InChIKey | HYOZNQOLBGCYEB-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |