C12H12FN5O2 — CID 136775733
methyl 7-(5-fluoro-2-pyridinyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate (PubChem CID 136775733) has the molecular formula C12H12FN5O2 and a molecular weight of 277.26 g/mol. Its IUPAC name is methyl 7-(5-fluoro-2-pyridinyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate.
| Compound Name | methyl 7-(5-fluoro-2-pyridinyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 136775733 |
| Molecular Formula | C12H12FN5O2 |
| Molecular Weight | 277.26 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | methyl 7-(5-fluoro-2-pyridinyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate |
| SMILES | COC(=O)c1nc2n(n1)C(c1ccc(F)cn1)CCN2 |
| InChI | InChI=1S/C12H12FN5O2/c1-20-11(19)10-16-12-14-5-4-9(18(12)17-10)8-3-2-7(13)6-15-8/h2-3,6,9H,4-5H2,1H3,(H,14,16,17) |
| InChIKey | OWEXCTMEGJCIPZ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.26 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |