C14H15FN6 — CID 136841337
9-(5-fluoro-2-pyridinyl)-3,5-dimethyl-4,5,7,8,12-pentazatricyclo[6.4.0.02,6]dodeca-1,3,6-triene (PubChem CID 136841337) has the molecular formula C14H15FN6 and a molecular weight of 286.31 g/mol. Its IUPAC name is 9-(5-fluoro-2-pyridinyl)-3,5-dimethyl-4,5,7,8,12-pentazatricyclo[6.4.0.02,6]dodeca-1,3,6-triene.
| Compound Name | 9-(5-fluoro-2-pyridinyl)-3,5-dimethyl-4,5,7,8,12-pentazatricyclo[6.4.0.02,6]dodeca-1,3,6-triene |
|---|---|
| PubChem CID | 136841337 |
| Molecular Formula | C14H15FN6 |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 9-(5-fluoro-2-pyridinyl)-3,5-dimethyl-4,5,7,8,12-pentazatricyclo[6.4.0.02,6]dodeca-1,3,6-triene |
| SMILES | Cc1nn(C)c2nn3c(c12)NCCC3c1ccc(F)cn1 |
| InChI | InChI=1S/C14H15FN6/c1-8-12-13-16-6-5-11(10-4-3-9(15)7-17-10)21(13)19-14(12)20(2)18-8/h3-4,7,11,16H,5-6H2,1-2H3 |
| InChIKey | HMWMCBVCMOPYQK-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |