C16H19N5 — CID 136841330
3,5-dimethyl-9-(4-methylphenyl)-4,5,7,8,12-pentazatricyclo[6.4.0.02,6]dodeca-1,3,6-triene (PubChem CID 136841330) has the molecular formula C16H19N5 and a molecular weight of 281.36 g/mol. Its IUPAC name is 3,5-dimethyl-9-(4-methylphenyl)-4,5,7,8,12-pentazatricyclo[6.4.0.02,6]dodeca-1,3,6-triene.
| Compound Name | 3,5-dimethyl-9-(4-methylphenyl)-4,5,7,8,12-pentazatricyclo[6.4.0.02,6]dodeca-1,3,6-triene |
|---|---|
| PubChem CID | 136841330 |
| Molecular Formula | C16H19N5 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 3,5-dimethyl-9-(4-methylphenyl)-4,5,7,8,12-pentazatricyclo[6.4.0.02,6]dodeca-1,3,6-triene |
| SMILES | Cc1ccc(C2CCNc3c4c(C)nn(C)c4nn32)cc1 |
| InChI | InChI=1S/C16H19N5/c1-10-4-6-12(7-5-10)13-8-9-17-15-14-11(2)18-20(3)16(14)19-21(13)15/h4-7,13,17H,8-9H2,1-3H3 |
| InChIKey | BXVHICOESIAISJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |