C13H16N4 — CID 136709421
7-(3,5-dimethylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 136709421) has the molecular formula C13H16N4 and a molecular weight of 228.30 g/mol. Its IUPAC name is 7-(3,5-dimethylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 7-(3,5-dimethylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 136709421 |
| Molecular Formula | C13H16N4 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 7-(3,5-dimethylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | Cc1cc(C)cc(C2CCNc3ncnn32)c1 |
| InChI | InChI=1S/C13H16N4/c1-9-5-10(2)7-11(6-9)12-3-4-14-13-15-8-16-17(12)13/h5-8,12H,3-4H2,1-2H3,(H,14,15,16) |
| InChIKey | GMFCPOMJVIARIN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |