C33H23ClN2O8 — CID 136711816
6-[(2-chlorophenyl)methyl]-3,19,21,26-tetrahydroxy-15-methoxy-20-methyl-6,7-diazahexacyclo[12.12.0.02,11.04,9.016,25.018,23]hexacosa-1(14),2(11),3,7,9,15,18,20,22,25-decaene-5,17,24-trione (PubChem CID 136711816) has the molecular formula C33H23ClN2O8 and a molecular weight of 611.01 g/mol. Its IUPAC name is 6-[(2-chlorophenyl)methyl]-3,19,21,26-tetrahydroxy-15-methoxy-20-methyl-6,7-diazahexacyclo[12.12.0.02,11.04,9.016,25.018,23]hexacosa-1(14),2(11),3,7,9,15,18,20,22,25-decaene-5,17,24-trione.
| Compound Name | 6-[(2-chlorophenyl)methyl]-3,19,21,26-tetrahydroxy-15-methoxy-20-methyl-6,7-diazahexacyclo[12.12.0.02,11.04,9.016,25.018,23]hexacosa-1(14),2(11),3,7,9,15,18,20,22,25-decaene-5,17,24-trione |
|---|---|
| PubChem CID | 136711816 |
| Molecular Formula | C33H23ClN2O8 |
| Molecular Weight | 611.01 g/mol |
| Exact Mass | 610.11 |
| IUPAC Name | 6-[(2-chlorophenyl)methyl]-3,19,21,26-tetrahydroxy-15-methoxy-20-methyl-6,7-diazahexacyclo[12.12.0.02,11.04,9.016,25.018,23]hexacosa-1(14),2(11),3,7,9,15,18,20,22,25-decaene-5,17,24-trione |
| SMILES | COc1c2c(c(O)c3c1C(=O)c1c(cc(O)c(C)c1O)C3=O)-c1c(cc3cnn(Cc4ccccc4Cl)c(=O)c3c1O)CC2 |
| InChI | InChI=1S/C33H23ClN2O8/c1-13-20(37)10-18-24(27(13)38)31(42)26-25(28(18)39)30(41)23-17(32(26)44-2)8-7-14-9-16-11-35-36(12-15-5-3-4-6-19(15)34)33(43)22(16)29(40)21(14)23/h3-6,9-11,37-38,40-41H,7-8,12H2,1-2H3 |
| InChIKey | PGJJWXCDAXPOOU-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 159.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.01 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|