C32H21ClN2O8 — CID 136711815
6-(2-chlorophenyl)-3,19,21,26-tetrahydroxy-15-methoxy-20-methyl-6,7-diazahexacyclo[12.12.0.02,11.04,9.016,25.018,23]hexacosa-1(14),2(11),3,7,9,15,18,20,22,25-decaene-5,17,24-trione (PubChem CID 136711815) has the molecular formula C32H21ClN2O8 and a molecular weight of 596.98 g/mol. Its IUPAC name is 6-(2-chlorophenyl)-3,19,21,26-tetrahydroxy-15-methoxy-20-methyl-6,7-diazahexacyclo[12.12.0.02,11.04,9.016,25.018,23]hexacosa-1(14),2(11),3,7,9,15,18,20,22,25-decaene-5,17,24-trione.
| Compound Name | 6-(2-chlorophenyl)-3,19,21,26-tetrahydroxy-15-methoxy-20-methyl-6,7-diazahexacyclo[12.12.0.02,11.04,9.016,25.018,23]hexacosa-1(14),2(11),3,7,9,15,18,20,22,25-decaene-5,17,24-trione |
|---|---|
| PubChem CID | 136711815 |
| Molecular Formula | C32H21ClN2O8 |
| Molecular Weight | 596.98 g/mol |
| Exact Mass | 596.10 |
| IUPAC Name | 6-(2-chlorophenyl)-3,19,21,26-tetrahydroxy-15-methoxy-20-methyl-6,7-diazahexacyclo[12.12.0.02,11.04,9.016,25.018,23]hexacosa-1(14),2(11),3,7,9,15,18,20,22,25-decaene-5,17,24-trione |
| SMILES | COc1c2c(c(O)c3c1C(=O)c1c(cc(O)c(C)c1O)C3=O)-c1c(cc3cnn(-c4ccccc4Cl)c(=O)c3c1O)CC2 |
| InChI | InChI=1S/C32H21ClN2O8/c1-12-19(36)10-16-23(26(12)37)30(41)25-24(27(16)38)29(40)22-15(31(25)43-2)8-7-13-9-14-11-34-35(18-6-4-3-5-17(18)33)32(42)21(14)28(39)20(13)22/h3-6,9-11,36-37,39-40H,7-8H2,1-2H3 |
| InChIKey | PPWCOCVNCRQIEZ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 159.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.98 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|