C21H18O5 — CID 142963306
(8S)-8-acetyl-11-hydroxy-6-methoxy-7,8,9,10-tetrahydrotetracene-5,12-dione (PubChem CID 142963306) has the molecular formula C21H18O5 and a molecular weight of 350.37 g/mol. Its IUPAC name is (8S)-8-acetyl-11-hydroxy-6-methoxy-7,8,9,10-tetrahydrotetracene-5,12-dione.
| Compound Name | (8S)-8-acetyl-11-hydroxy-6-methoxy-7,8,9,10-tetrahydrotetracene-5,12-dione |
|---|---|
| PubChem CID | 142963306 |
| Molecular Formula | C21H18O5 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | (8S)-8-acetyl-11-hydroxy-6-methoxy-7,8,9,10-tetrahydrotetracene-5,12-dione |
| SMILES | COc1c2c(c(O)c3c1C(=O)c1ccccc1C3=O)CC[C@H](C(C)=O)C2 |
| InChI | InChI=1S/C21H18O5/c1-10(22)11-7-8-14-15(9-11)21(26-2)17-16(19(14)24)18(23)12-5-3-4-6-13(12)20(17)25/h3-6,11,24H,7-9H2,1-2H3/t11-/m0/s1 |
| InChIKey | TVKAVKDYMZCFHF-NSHDSACASA-N |
| XLogP | 2.87 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|