C19H14O6 — CID 23356072
3-acetyl-5,12-dihydroxy-3,4-dihydro-1H-naphtho[2,3-g]isochromene-6,11-dione (PubChem CID 23356072) has the molecular formula C19H14O6 and a molecular weight of 338.32 g/mol. Its IUPAC name is 3-acetyl-5,12-dihydroxy-3,4-dihydro-1H-naphtho[2,3-g]isochromene-6,11-dione.
| Compound Name | 3-acetyl-5,12-dihydroxy-3,4-dihydro-1H-naphtho[2,3-g]isochromene-6,11-dione |
|---|---|
| PubChem CID | 23356072 |
| Molecular Formula | C19H14O6 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 3-acetyl-5,12-dihydroxy-3,4-dihydro-1H-naphtho[2,3-g]isochromene-6,11-dione |
| SMILES | CC(=O)C1Cc2c(O)c3c(c(O)c2CO1)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C19H14O6/c1-8(20)13-6-11-12(7-25-13)19(24)15-14(18(11)23)16(21)9-4-2-3-5-10(9)17(15)22/h2-5,13,23-24H,6-7H2,1H3 |
| InChIKey | WCYUJTICJCMJNQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|