C21H19NO5 — CID 138614697
(8S)-8-acetyl-6,11-dihydroxy-1-(methylamino)-7,8,9,10-tetrahydrotetracene-5,12-dione (PubChem CID 138614697) has the molecular formula C21H19NO5 and a molecular weight of 365.39 g/mol. Its IUPAC name is (8S)-8-acetyl-6,11-dihydroxy-1-(methylamino)-7,8,9,10-tetrahydrotetracene-5,12-dione.
| Compound Name | (8S)-8-acetyl-6,11-dihydroxy-1-(methylamino)-7,8,9,10-tetrahydrotetracene-5,12-dione |
|---|---|
| PubChem CID | 138614697 |
| Molecular Formula | C21H19NO5 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | (8S)-8-acetyl-6,11-dihydroxy-1-(methylamino)-7,8,9,10-tetrahydrotetracene-5,12-dione |
| SMILES | CNc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)C[C@@H](C(C)=O)CC3 |
| InChI | InChI=1S/C21H19NO5/c1-9(23)10-6-7-11-13(8-10)20(26)16-17(18(11)24)21(27)15-12(19(16)25)4-3-5-14(15)22-2/h3-5,10,22,24,26H,6-8H2,1-2H3/t10-/m0/s1 |
| InChIKey | QOOCGPFCNIUXBD-JTQLQIEISA-N |
| XLogP | 2.61 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|