C22H18O6 — CID 11199784
5-acetyl-2,10-dimethoxy-6-oxapentacyclo[9.8.0.03,9.05,7.013,18]nonadeca-1,3(9),10,13,15,17-hexaene-12,19-dione (PubChem CID 11199784) has the molecular formula C22H18O6 and a molecular weight of 378.38 g/mol. Its IUPAC name is 5-acetyl-2,10-dimethoxy-6-oxapentacyclo[9.8.0.03,9.05,7.013,18]nonadeca-1,3(9),10,13,15,17-hexaene-12,19-dione.
| Compound Name | 5-acetyl-2,10-dimethoxy-6-oxapentacyclo[9.8.0.03,9.05,7.013,18]nonadeca-1,3(9),10,13,15,17-hexaene-12,19-dione |
|---|---|
| PubChem CID | 11199784 |
| Molecular Formula | C22H18O6 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 5-acetyl-2,10-dimethoxy-6-oxapentacyclo[9.8.0.03,9.05,7.013,18]nonadeca-1,3(9),10,13,15,17-hexaene-12,19-dione |
| SMILES | COc1c2c(c(OC)c3c1C(=O)c1ccccc1C3=O)CC1(C(C)=O)OC1C2 |
| InChI | InChI=1S/C22H18O6/c1-10(23)22-9-14-13(8-15(22)28-22)20(26-2)16-17(21(14)27-3)19(25)12-7-5-4-6-11(12)18(16)24/h4-7,15H,8-9H2,1-3H3 |
| InChIKey | GAXTWSULCWTBGB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 82.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|