C16H12N2O2S — CID 136713861
4-[(4-oxo-3H-quinazolin-2-yl)methylsulfanyl]benzaldehyde (PubChem CID 136713861) has the molecular formula C16H12N2O2S and a molecular weight of 296.35 g/mol. Its IUPAC name is 4-[(4-oxo-3H-quinazolin-2-yl)methylsulfanyl]benzaldehyde.
| Compound Name | 4-[(4-oxo-3H-quinazolin-2-yl)methylsulfanyl]benzaldehyde |
|---|---|
| PubChem CID | 136713861 |
| Molecular Formula | C16H12N2O2S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 4-[(4-oxo-3H-quinazolin-2-yl)methylsulfanyl]benzaldehyde |
| SMILES | O=Cc1ccc(SCc2nc3ccccc3c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C16H12N2O2S/c19-9-11-5-7-12(8-6-11)21-10-15-17-14-4-2-1-3-13(14)16(20)18-15/h1-9H,10H2,(H,17,18,20) |
| InChIKey | TVOOYAHAGHXUKU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|