C18H14N4O2 — CID 136716145
(2R,3E,4E,5S)-3,4-bis(hydroxyimino)-2,5-diphenylhexanedinitrile (PubChem CID 136716145) has the molecular formula C18H14N4O2 and a molecular weight of 318.34 g/mol. Its IUPAC name is (2R,3E,4E,5S)-3,4-bis(hydroxyimino)-2,5-diphenylhexanedinitrile.
| Compound Name | (2R,3E,4E,5S)-3,4-bis(hydroxyimino)-2,5-diphenylhexanedinitrile |
|---|---|
| PubChem CID | 136716145 |
| Molecular Formula | C18H14N4O2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | (2R,3E,4E,5S)-3,4-bis(hydroxyimino)-2,5-diphenylhexanedinitrile |
| SMILES | N#C[C@H](C(=N\O)/C(=N/O)[C@H](C#N)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H14N4O2/c19-11-15(13-7-3-1-4-8-13)17(21-23)18(22-24)16(12-20)14-9-5-2-6-10-14/h1-10,15-16,23-24H/b21-17+,22-18+/t15-,16+ |
| InChIKey | QMGCWINKDOTCDD-BWALQORKSA-N |
| XLogP | 3.26 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|