C15H12N2 — CID 123903802
3-imino-2,3-diphenylpropanenitrile (PubChem CID 123903802) has the molecular formula C15H12N2 and a molecular weight of 220.28 g/mol. Its IUPAC name is 3-imino-2,3-diphenylpropanenitrile.
| Compound Name | 3-imino-2,3-diphenylpropanenitrile |
|---|---|
| PubChem CID | 123903802 |
| Molecular Formula | C15H12N2 |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 3-imino-2,3-diphenylpropanenitrile |
| SMILES | [H]/N=C(\c1ccccc1)C(C#N)c1ccccc1 |
| InChI | InChI=1S/C15H12N2/c16-11-14(12-7-3-1-4-8-12)15(17)13-9-5-2-6-10-13/h1-10,14,17H/b17-15+ |
| InChIKey | FLTZPMWLRXCWFG-BMRADRMJSA-N |
| XLogP | 3.36 |
| TPSA | 47.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|