C48H34N6 — CID 136716524
5,10,15,20-tetraphenyl-3-pyrrol-1-yl-21,23-dihydroporphyrin-2-amine (PubChem CID 136716524) has the molecular formula C48H34N6 and a molecular weight of 694.84 g/mol. Its IUPAC name is 5,10,15,20-tetraphenyl-3-pyrrol-1-yl-21,23-dihydroporphyrin-2-amine.
| Compound Name | 5,10,15,20-tetraphenyl-3-pyrrol-1-yl-21,23-dihydroporphyrin-2-amine |
|---|---|
| PubChem CID | 136716524 |
| Molecular Formula | C48H34N6 |
| Molecular Weight | 694.84 g/mol |
| Exact Mass | 694.28 |
| IUPAC Name | 5,10,15,20-tetraphenyl-3-pyrrol-1-yl-21,23-dihydroporphyrin-2-amine |
| SMILES | Nc1c(-n2cccc2)c2[nH]c1c(-c1ccccc1)c1nc(c(-c3ccccc3)c3ccc([nH]3)c(-c3ccccc3)c3nc(c2-c2ccccc2)C=C3)C=C1 |
| InChI | InChI=1S/C48H34N6/c49-45-46-43(33-19-9-3-10-20-33)39-27-25-37(51-39)41(31-15-5-1-6-16-31)35-23-24-36(50-35)42(32-17-7-2-8-18-32)38-26-28-40(52-38)44(34-21-11-4-12-22-34)47(53-46)48(45)54-29-13-14-30-54/h1-30,50,53H,49H2/b41-35-,41-37-,42-36-,42-38-,43-39-,44-40-,46-43-,47-44- |
| InChIKey | AMQNUVCYJNLUJB-BQMKKPOSSA-N |
| XLogP | 11.70 |
| TPSA | 88.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.84 |
| LogP ≤ 5 | 11.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |