C18H17N3OS2 — CID 136720519
5-[(2-cyclopropyl-1,3-thiazol-4-yl)methylidene]-2-(2,6-dimethylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 136720519) has the molecular formula C18H17N3OS2 and a molecular weight of 355.49 g/mol. Its IUPAC name is 5-[(2-cyclopropyl-1,3-thiazol-4-yl)methylidene]-2-(2,6-dimethylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | 5-[(2-cyclopropyl-1,3-thiazol-4-yl)methylidene]-2-(2,6-dimethylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136720519 |
| Molecular Formula | C18H17N3OS2 |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 5-[(2-cyclopropyl-1,3-thiazol-4-yl)methylidene]-2-(2,6-dimethylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | Cc1cccc(C)c1/N=C1/NC(=O)C(=Cc2csc(C3CC3)n2)S1 |
| InChI | InChI=1S/C18H17N3OS2/c1-10-4-3-5-11(2)15(10)20-18-21-16(22)14(24-18)8-13-9-23-17(19-13)12-6-7-12/h3-5,8-9,12H,6-7H2,1-2H3,(H,20,21,22) |
| InChIKey | SLISDIPVUYOIKV-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|